C21H27PTi — CID 87829923
2-butyl-3-methylcyclopenta-1,3-diene;1H-inden-1-id-2-yl(dimethyl)phosphane;titanium(2+) (PubChem CID 87829923) has the molecular formula C21H27PTi and a molecular weight of 358.29 g/mol. Its IUPAC name is 2-butyl-3-methylcyclopenta-1,3-diene;1H-inden-1-id-2-yl(dimethyl)phosphane;titanium(2+).
| Compound Name | 2-butyl-3-methylcyclopenta-1,3-diene;1H-inden-1-id-2-yl(dimethyl)phosphane;titanium(2+) |
|---|---|
| PubChem CID | 87829923 |
| Molecular Formula | C21H27PTi |
| Molecular Weight | 358.29 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 2-butyl-3-methylcyclopenta-1,3-diene;1H-inden-1-id-2-yl(dimethyl)phosphane;titanium(2+) |
| SMILES | CCCCC1=[C-]CC=C1C.CP(C)c1cc2ccccc2[cH-]1.[Ti+2] |
| InChI | InChI=1S/C11H12P.C10H15.Ti/c1-12(2)11-7-9-5-3-4-6-10(9)8-11;1-3-4-7-10-8-5-6-9(10)2;/h3-8H,1-2H3;6H,3-5,7H2,1-2H3;/q2*-1;+2 |
| InChIKey | VTUOUBCMNSJIAZ-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.29 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|