C28H35Fe2NO — CID 131740901
6-[bis(cyclopenta-1,3-dien-1-ylmethyl)amino]hexan-1-ol;bis(cyclopenta-1,3-diene);bis(iron(2+)) (PubChem CID 131740901) has the molecular formula C28H35Fe2NO and a molecular weight of 513.28 g/mol. Its IUPAC name is 6-[bis(cyclopenta-1,3-dien-1-ylmethyl)amino]hexan-1-ol;bis(cyclopenta-1,3-diene);bis(iron(2+)).
| Compound Name | 6-[bis(cyclopenta-1,3-dien-1-ylmethyl)amino]hexan-1-ol;bis(cyclopenta-1,3-diene);bis(iron(2+)) |
|---|---|
| PubChem CID | 131740901 |
| Molecular Formula | C28H35Fe2NO |
| Molecular Weight | 513.28 g/mol |
| Exact Mass | 513.14 |
| IUPAC Name | 6-[bis(cyclopenta-1,3-dien-1-ylmethyl)amino]hexan-1-ol;bis(cyclopenta-1,3-diene);bis(iron(2+)) |
| SMILES | OCCCCCCN(Cc1ccc[cH-]1)Cc1ccc[cH-]1.[Fe+2].[Fe+2].c1cc[cH-]c1.c1cc[cH-]c1 |
| InChI | InChI=1S/C18H25NO.2C5H5.2Fe/c20-14-8-2-1-7-13-19(15-17-9-3-4-10-17)16-18-11-5-6-12-18;2*1-2-4-5-3-1;;/h3-6,9-12,20H,1-2,7-8,13-16H2;2*1-5H;;/q-2;2*-1;2*+2 |
| InChIKey | DRDVSWLNCPMDMD-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.28 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|