C21H34FeNO3P — CID 175689197
cyclopenta-1,3-diene;2-(3-cyclopenta-1,3-dien-1-ylpropoxy)ethoxy-N,N-di(propan-2-yl)phosphonamidous acid;iron(2+) (PubChem CID 175689197) has the molecular formula C21H34FeNO3P and a molecular weight of 435.33 g/mol. Its IUPAC name is cyclopenta-1,3-diene;2-(3-cyclopenta-1,3-dien-1-ylpropoxy)ethoxy-N,N-di(propan-2-yl)phosphonamidous acid;iron(2+).
| Compound Name | cyclopenta-1,3-diene;2-(3-cyclopenta-1,3-dien-1-ylpropoxy)ethoxy-N,N-di(propan-2-yl)phosphonamidous acid;iron(2+) |
|---|---|
| PubChem CID | 175689197 |
| Molecular Formula | C21H34FeNO3P |
| Molecular Weight | 435.33 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | cyclopenta-1,3-diene;2-(3-cyclopenta-1,3-dien-1-ylpropoxy)ethoxy-N,N-di(propan-2-yl)phosphonamidous acid;iron(2+) |
| SMILES | CC(C)N(C(C)C)P(O)OCCOCCCc1ccc[cH-]1.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C16H29NO3P.C5H5.Fe/c1-14(2)17(15(3)4)21(18)20-13-12-19-11-7-10-16-8-5-6-9-16;1-2-4-5-3-1;/h5-6,8-9,14-15,18H,7,10-13H2,1-4H3;1-5H;/q2*-1;+2 |
| InChIKey | LMMOOAABXRJODW-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.33 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|