C11H27NO5P2 — CID 155355291
3-dimethoxyphosphorylpropoxy-N,N-di(propan-2-yl)phosphonamidous acid (PubChem CID 155355291) has the molecular formula C11H27NO5P2 and a molecular weight of 315.29 g/mol. Its IUPAC name is 3-dimethoxyphosphorylpropoxy-N,N-di(propan-2-yl)phosphonamidous acid.
| Compound Name | 3-dimethoxyphosphorylpropoxy-N,N-di(propan-2-yl)phosphonamidous acid |
|---|---|
| PubChem CID | 155355291 |
| Molecular Formula | C11H27NO5P2 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 3-dimethoxyphosphorylpropoxy-N,N-di(propan-2-yl)phosphonamidous acid |
| SMILES | COP(=O)(CCCOP(O)N(C(C)C)C(C)C)OC |
| InChI | InChI=1S/C11H27NO5P2/c1-10(2)12(11(3)4)18(13)17-8-7-9-19(14,15-5)16-6/h10-11,13H,7-9H2,1-6H3 |
| InChIKey | MSDKDBLWZIJNOS-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|