C13H28NO3PS — CID 15870030
2-(2,2-dimethylpropanoylsulfanyl)ethoxy-N,N-di(propan-2-yl)phosphonamidous acid (PubChem CID 15870030) has the molecular formula C13H28NO3PS and a molecular weight of 309.41 g/mol. Its IUPAC name is 2-(2,2-dimethylpropanoylsulfanyl)ethoxy-N,N-di(propan-2-yl)phosphonamidous acid.
| Compound Name | 2-(2,2-dimethylpropanoylsulfanyl)ethoxy-N,N-di(propan-2-yl)phosphonamidous acid |
|---|---|
| PubChem CID | 15870030 |
| Molecular Formula | C13H28NO3PS |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 2-(2,2-dimethylpropanoylsulfanyl)ethoxy-N,N-di(propan-2-yl)phosphonamidous acid |
| SMILES | CC(C)N(C(C)C)P(O)OCCSC(=O)C(C)(C)C |
| InChI | InChI=1S/C13H28NO3PS/c1-10(2)14(11(3)4)18(16)17-8-9-19-12(15)13(5,6)7/h10-11,16H,8-9H2,1-7H3 |
| InChIKey | OBCUDWUZQOWFED-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|