C21H42N3O7PS3 — CID 141213643
S-[2-[bis[[2-(2,2-dimethylpropanoylsulfanyl)ethylamino]oxy]phosphoryloxyamino]ethyl] 2,2-dimethylpropanethioate (PubChem CID 141213643) has the molecular formula C21H42N3O7PS3 and a molecular weight of 575.76 g/mol. Its IUPAC name is S-[2-[bis[[2-(2,2-dimethylpropanoylsulfanyl)ethylamino]oxy]phosphoryloxyamino]ethyl] 2,2-dimethylpropanethioate.
| Compound Name | S-[2-[bis[[2-(2,2-dimethylpropanoylsulfanyl)ethylamino]oxy]phosphoryloxyamino]ethyl] 2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 141213643 |
| Molecular Formula | C21H42N3O7PS3 |
| Molecular Weight | 575.76 g/mol |
| Exact Mass | 575.19 |
| IUPAC Name | S-[2-[bis[[2-(2,2-dimethylpropanoylsulfanyl)ethylamino]oxy]phosphoryloxyamino]ethyl] 2,2-dimethylpropanethioate |
| SMILES | CC(C)(C)C(=O)SCCNOP(=O)(ONCCSC(=O)C(C)(C)C)ONCCSC(=O)C(C)(C)C |
| InChI | InChI=1S/C21H42N3O7PS3/c1-19(2,3)16(25)33-13-10-22-29-32(28,30-23-11-14-34-17(26)20(4,5)6)31-24-12-15-35-18(27)21(7,8)9/h22-24H,10-15H2,1-9H3 |
| InChIKey | USCIOJHKDOTKCW-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.76 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|