C18H36NO5PS — CID 134571222
ethyl (2S)-2-[[2-(2,2-dimethylpropanoylsulfanyl)ethoxy-propan-2-ylphosphoryl]amino]-4-methylpentanoate (PubChem CID 134571222) has the molecular formula C18H36NO5PS and a molecular weight of 409.53 g/mol. Its IUPAC name is ethyl (2S)-2-[[2-(2,2-dimethylpropanoylsulfanyl)ethoxy-propan-2-ylphosphoryl]amino]-4-methylpentanoate.
| Compound Name | ethyl (2S)-2-[[2-(2,2-dimethylpropanoylsulfanyl)ethoxy-propan-2-ylphosphoryl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 134571222 |
| Molecular Formula | C18H36NO5PS |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | ethyl (2S)-2-[[2-(2,2-dimethylpropanoylsulfanyl)ethoxy-propan-2-ylphosphoryl]amino]-4-methylpentanoate |
| SMILES | CCOC(=O)[C@H](CC(C)C)NP(=O)(OCCSC(=O)C(C)(C)C)C(C)C |
| InChI | InChI=1S/C18H36NO5PS/c1-9-23-16(20)15(12-13(2)3)19-25(22,14(4)5)24-10-11-26-17(21)18(6,7)8/h13-15H,9-12H2,1-8H3,(H,19,22)/t15-,25?/m0/s1 |
| InChIKey | MSWVAAGZYUCPHA-JMTKMGNOSA-N |
| XLogP | 4.48 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|