C11H18O4S — CID 162497415
ethyl 3-(2,2-dimethylpropanoylsulfanyl)-2-methyl-3-oxopropanoate (PubChem CID 162497415) has the molecular formula C11H18O4S and a molecular weight of 246.33 g/mol. Its IUPAC name is ethyl 3-(2,2-dimethylpropanoylsulfanyl)-2-methyl-3-oxopropanoate.
| Compound Name | ethyl 3-(2,2-dimethylpropanoylsulfanyl)-2-methyl-3-oxopropanoate |
|---|---|
| PubChem CID | 162497415 |
| Molecular Formula | C11H18O4S |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | ethyl 3-(2,2-dimethylpropanoylsulfanyl)-2-methyl-3-oxopropanoate |
| SMILES | CCOC(=O)C(C)C(=O)SC(=O)C(C)(C)C |
| InChI | InChI=1S/C11H18O4S/c1-6-15-8(12)7(2)9(13)16-10(14)11(3,4)5/h7H,6H2,1-5H3 |
| InChIKey | UHTPAPDRZSHVPG-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|