About ethyl (2S)-2-aminopropanoate;molecular hydrogen
ethyl (2S)-2-aminopropanoate;molecular hydrogen (PubChem CID 145195719) has the molecular formula C5H13NO2
and a molecular weight of 119.16 g/mol. Its IUPAC name is ethyl (2S)-2-aminopropanoate;molecular hydrogen.
Molecular Properties
| Compound Name | ethyl (2S)-2-aminopropanoate;molecular hydrogen |
| PubChem CID | 145195719 |
| Molecular Formula | C5H13NO2 |
| Molecular Weight | 119.16 g/mol |
| Exact Mass | 119.09 |
| IUPAC Name | ethyl (2S)-2-aminopropanoate;molecular hydrogen |
| SMILES | CCOC(=O)[C@H](C)N.[H][H] |
| InChI | InChI=1S/C5H11NO2.H2/c1-3-8-5(7)4(2)6;/h4H,3,6H2,1-2H3;1H/t4-;/m0./s1 |
| InChIKey | RKQUXEOSDWGLGH-WCCKRBBISA-N |
| XLogP | 0.14 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.16 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl (2S)-2-aminopropanoate;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2S)-2-aminopropanoate;molecular hydrogen?
The IUPAC name of ethyl (2S)-2-aminopropanoate;molecular hydrogen (CID 145195719) is ethyl (2S)-2-aminopropanoate;molecular hydrogen.
What is the SMILES notation for ethyl (2S)-2-aminopropanoate;molecular hydrogen?
The canonical SMILES for ethyl (2S)-2-aminopropanoate;molecular hydrogen is CCOC(=O)[C@H](C)N.[H][H].
What is the InChIKey of ethyl (2S)-2-aminopropanoate;molecular hydrogen?
The InChIKey is RKQUXEOSDWGLGH-WCCKRBBISA-N. The full InChI is InChI=1S/C5H11NO2.H2/c1-3-8-5(7)4(2)6;/h4H,3,6H2,1-2H3;1H/t4-;/m0./s1.
What are the key properties of ethyl (2S)-2-aminopropanoate;molecular hydrogen?
ethyl (2S)-2-aminopropanoate;molecular hydrogen has a molecular weight of 119.16 g/mol, XLogP of 0.14, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2S)-2-aminopropanoate;molecular hydrogen is sourced from PubChem (CID 145195719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).