C14H22O8S2 — CID 139622070
diethyl 2-[(1,3-diethoxy-1,3-dioxopropan-2-yl)disulfanyl]propanedioate (PubChem CID 139622070) has the molecular formula C14H22O8S2 and a molecular weight of 382.46 g/mol. Its IUPAC name is diethyl 2-[(1,3-diethoxy-1,3-dioxopropan-2-yl)disulfanyl]propanedioate.
| Compound Name | diethyl 2-[(1,3-diethoxy-1,3-dioxopropan-2-yl)disulfanyl]propanedioate |
|---|---|
| PubChem CID | 139622070 |
| Molecular Formula | C14H22O8S2 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | diethyl 2-[(1,3-diethoxy-1,3-dioxopropan-2-yl)disulfanyl]propanedioate |
| SMILES | CCOC(=O)C(SSC(C(=O)OCC)C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C14H22O8S2/c1-5-19-11(15)9(12(16)20-6-2)23-24-10(13(17)21-7-3)14(18)22-8-4/h9-10H,5-8H2,1-4H3 |
| InChIKey | COBMRJDJHBTLGI-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|