C4H8O2S2 — CID 21446775
ethyl 2,2-bis(sulfanyl)acetate (PubChem CID 21446775) has the molecular formula C4H8O2S2 and a molecular weight of 152.24 g/mol. Its IUPAC name is ethyl 2,2-bis(sulfanyl)acetate.
| Compound Name | ethyl 2,2-bis(sulfanyl)acetate |
|---|---|
| PubChem CID | 21446775 |
| Molecular Formula | C4H8O2S2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.00 |
| IUPAC Name | ethyl 2,2-bis(sulfanyl)acetate |
| SMILES | CCOC(=O)C(S)S |
| InChI | InChI=1S/C4H8O2S2/c1-2-6-3(5)4(7)8/h4,7-8H,2H2,1H3 |
| InChIKey | NWLNWUSPPSNGFL-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|