About ethyl 2-[[(2R)-2-[1-(hydroxyamino)-1-oxopropan-2-yl]-4-methylpentanoyl]amino]-3,3-dimethylbutanoate
ethyl 2-[[(2R)-2-[1-(hydroxyamino)-1-oxopropan-2-yl]-4-methylpentanoyl]amino]-3,3-dimethylbutanoate (PubChem CID 142008467) has the molecular formula C17H32N2O5
and a molecular weight of 344.45 g/mol. Its IUPAC name is ethyl 2-[[(2R)-2-[1-(hydroxyamino)-1-oxopropan-2-yl]-4-methylpentanoyl]amino]-3,3-dimethylbutanoate.
Molecular Properties
| Compound Name | ethyl 2-[[(2R)-2-[1-(hydroxyamino)-1-oxopropan-2-yl]-4-methylpentanoyl]amino]-3,3-dimethylbutanoate |
| PubChem CID | 142008467 |
| Molecular Formula | C17H32N2O5 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.23 |
| IUPAC Name | ethyl 2-[[(2R)-2-[1-(hydroxyamino)-1-oxopropan-2-yl]-4-methylpentanoyl]amino]-3,3-dimethylbutanoate |
| SMILES | CCOC(=O)C(NC(=O)[C@H](CC(C)C)C(C)C(=O)NO)C(C)(C)C |
| InChI | InChI=1S/C17H32N2O5/c1-8-24-16(22)13(17(5,6)7)18-15(21)12(9-10(2)3)11(4)14(20)19-23/h10-13,23H,8-9H2,1-7H3,(H,18,21)(H,19,20)/t11?,12-,13?/m1/s1 |
| InChIKey | HZCFLWOYVHLWLM-OTTFEQOBSA-N |
| XLogP | 1.88 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[[(2R)-2-[1-(hydroxyamino)-1-oxopropan-2-yl]-4-methylpentanoyl]amino]-3,3-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[[(2R)-2-[1-(hydroxyamino)-1-oxopropan-2-yl]-4-methylpentanoyl]amino]-3,3-dimethylbutanoate?
The IUPAC name of ethyl 2-[[(2R)-2-[1-(hydroxyamino)-1-oxopropan-2-yl]-4-methylpentanoyl]amino]-3,3-dimethylbutanoate (CID 142008467) is ethyl 2-[[(2R)-2-[1-(hydroxyamino)-1-oxopropan-2-yl]-4-methylpentanoyl]amino]-3,3-dimethylbutanoate.
What is the SMILES notation for ethyl 2-[[(2R)-2-[1-(hydroxyamino)-1-oxopropan-2-yl]-4-methylpentanoyl]amino]-3,3-dimethylbutanoate?
The canonical SMILES for ethyl 2-[[(2R)-2-[1-(hydroxyamino)-1-oxopropan-2-yl]-4-methylpentanoyl]amino]-3,3-dimethylbutanoate is CCOC(=O)C(NC(=O)[C@H](CC(C)C)C(C)C(=O)NO)C(C)(C)C.
What is the InChIKey of ethyl 2-[[(2R)-2-[1-(hydroxyamino)-1-oxopropan-2-yl]-4-methylpentanoyl]amino]-3,3-dimethylbutanoate?
The InChIKey is HZCFLWOYVHLWLM-OTTFEQOBSA-N. The full InChI is InChI=1S/C17H32N2O5/c1-8-24-16(22)13(17(5,6)7)18-15(21)12(9-10(2)3)11(4)14(20)19-23/h10-13,23H,8-9H2,1-7H3,(H,18,21)(H,19,20)/t11?,12-,13?/m1/s1.
What are the key properties of ethyl 2-[[(2R)-2-[1-(hydroxyamino)-1-oxopropan-2-yl]-4-methylpentanoyl]amino]-3,3-dimethylbutanoate?
ethyl 2-[[(2R)-2-[1-(hydroxyamino)-1-oxopropan-2-yl]-4-methylpentanoyl]amino]-3,3-dimethylbutanoate has a molecular weight of 344.45 g/mol, XLogP of 1.88, 8 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[[(2R)-2-[1-(hydroxyamino)-1-oxopropan-2-yl]-4-methylpentanoyl]amino]-3,3-dimethylbutanoate is sourced from PubChem (CID 142008467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).