C18H34N2O6 — CID 57205167
propan-2-yl (2S)-2-[[(2R)-2-[[2-(hydroxyamino)-2-oxoethoxy]methyl]-4-methylpentanoyl]amino]-3,3-dimethylbutanoate (PubChem CID 57205167) has the molecular formula C18H34N2O6 and a molecular weight of 374.48 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[(2R)-2-[[2-(hydroxyamino)-2-oxoethoxy]methyl]-4-methylpentanoyl]amino]-3,3-dimethylbutanoate.
| Compound Name | propan-2-yl (2S)-2-[[(2R)-2-[[2-(hydroxyamino)-2-oxoethoxy]methyl]-4-methylpentanoyl]amino]-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 57205167 |
| Molecular Formula | C18H34N2O6 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.24 |
| IUPAC Name | propan-2-yl (2S)-2-[[(2R)-2-[[2-(hydroxyamino)-2-oxoethoxy]methyl]-4-methylpentanoyl]amino]-3,3-dimethylbutanoate |
| SMILES | CC(C)C[C@H](COCC(=O)NO)C(=O)N[C@H](C(=O)OC(C)C)C(C)(C)C |
| InChI | InChI=1S/C18H34N2O6/c1-11(2)8-13(9-25-10-14(21)20-24)16(22)19-15(18(5,6)7)17(23)26-12(3)4/h11-13,15,24H,8-10H2,1-7H3,(H,19,22)(H,20,21)/t13-,15-/m1/s1 |
| InChIKey | WZQQUARXMOPHCM-UKRRQHHQSA-N |
| XLogP | 1.65 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|