C15H31N3O3 — CID 123941251
N-[3,3-dimethyl-1-(methylamino)butan-2-yl]-N'-hydroxy-2-(2-methylpropyl)butanediamide (PubChem CID 123941251) has the molecular formula C15H31N3O3 and a molecular weight of 301.43 g/mol. Its IUPAC name is N-[3,3-dimethyl-1-(methylamino)butan-2-yl]-N'-hydroxy-2-(2-methylpropyl)butanediamide.
| Compound Name | N-[3,3-dimethyl-1-(methylamino)butan-2-yl]-N'-hydroxy-2-(2-methylpropyl)butanediamide |
|---|---|
| PubChem CID | 123941251 |
| Molecular Formula | C15H31N3O3 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.24 |
| IUPAC Name | N-[3,3-dimethyl-1-(methylamino)butan-2-yl]-N'-hydroxy-2-(2-methylpropyl)butanediamide |
| SMILES | CNCC(NC(=O)C(CC(=O)NO)CC(C)C)C(C)(C)C |
| InChI | InChI=1S/C15H31N3O3/c1-10(2)7-11(8-13(19)18-21)14(20)17-12(9-16-6)15(3,4)5/h10-12,16,21H,7-9H2,1-6H3,(H,17,20)(H,18,19) |
| InChIKey | GXOXIGYIQRAPIL-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|