C27H52N4O6S2 — CID 158507208
N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-N'-hydroxy-2-(2-methylpropyl)butanediamide;3-[2-(dithiolan-4-yl)ethyl]-N-hydroxy-5-methylhexanamide (PubChem CID 158507208) has the molecular formula C27H52N4O6S2 and a molecular weight of 592.87 g/mol. Its IUPAC name is N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-N'-hydroxy-2-(2-methylpropyl)butanediamide;3-[2-(dithiolan-4-yl)ethyl]-N-hydroxy-5-methylhexanamide.
| Compound Name | N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-N'-hydroxy-2-(2-methylpropyl)butanediamide;3-[2-(dithiolan-4-yl)ethyl]-N-hydroxy-5-methylhexanamide |
|---|---|
| PubChem CID | 158507208 |
| Molecular Formula | C27H52N4O6S2 |
| Molecular Weight | 592.87 g/mol |
| Exact Mass | 592.33 |
| IUPAC Name | N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-N'-hydroxy-2-(2-methylpropyl)butanediamide;3-[2-(dithiolan-4-yl)ethyl]-N-hydroxy-5-methylhexanamide |
| SMILES | CC(C)CC(CCC1CSSC1)CC(=O)NO.CNC(=O)[C@@H](NC(=O)C(CC(=O)NO)CC(C)C)C(C)(C)C |
| InChI | InChI=1S/C15H29N3O4.C12H23NO2S2/c1-9(2)7-10(8-11(19)18-22)13(20)17-12(14(21)16-6)15(3,4)5;1-9(2)5-10(6-12(14)13-15)3-4-11-7-16-17-8-11/h9-10,12,22H,7-8H2,1-6H3,(H,16,21)(H,17,20)(H,18,19);9-11,15H,3-8H2,1-2H3,(H,13,14)/t10?,12-;/m1./s1 |
| InChIKey | HKPIYFRQRJSWIZ-ULIKACSMSA-N |
| XLogP | 4.16 |
| TPSA | 156.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.87 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|