C18H33N3O4S — CID 57161006
(2R)-N'-hydroxy-N-[3-methyl-1-(methylamino)-3-methylsulfanyl-1-oxobutan-2-yl]-2-(2-methylpropyl)-N'-prop-1-en-2-ylbutanediamide (PubChem CID 57161006) has the molecular formula C18H33N3O4S and a molecular weight of 387.55 g/mol. Its IUPAC name is (2R)-N'-hydroxy-N-[3-methyl-1-(methylamino)-3-methylsulfanyl-1-oxobutan-2-yl]-2-(2-methylpropyl)-N'-prop-1-en-2-ylbutanediamide.
| Compound Name | (2R)-N'-hydroxy-N-[3-methyl-1-(methylamino)-3-methylsulfanyl-1-oxobutan-2-yl]-2-(2-methylpropyl)-N'-prop-1-en-2-ylbutanediamide |
|---|---|
| PubChem CID | 57161006 |
| Molecular Formula | C18H33N3O4S |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | (2R)-N'-hydroxy-N-[3-methyl-1-(methylamino)-3-methylsulfanyl-1-oxobutan-2-yl]-2-(2-methylpropyl)-N'-prop-1-en-2-ylbutanediamide |
| SMILES | C=C(C)N(O)C(=O)C[C@@H](CC(C)C)C(=O)NC(C(=O)NC)C(C)(C)SC |
| InChI | InChI=1S/C18H33N3O4S/c1-11(2)9-13(10-14(22)21(25)12(3)4)16(23)20-15(17(24)19-7)18(5,6)26-8/h11,13,15,25H,3,9-10H2,1-2,4-8H3,(H,19,24)(H,20,23)/t13-,15?/m1/s1 |
| InChIKey | MOSSDEYBFYPZSR-AFYYWNPRSA-N |
| XLogP | 2.16 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|