C15H29N3O7S — CID 54385621
N,2-dihydroxy-N'-[3-methyl-1-(methylamino)-3-methylsulfonyl-1-oxobutan-2-yl]-3-(2-methylpropyl)butanediamide (PubChem CID 54385621) has the molecular formula C15H29N3O7S and a molecular weight of 395.48 g/mol. Its IUPAC name is N,2-dihydroxy-N'-[3-methyl-1-(methylamino)-3-methylsulfonyl-1-oxobutan-2-yl]-3-(2-methylpropyl)butanediamide.
| Compound Name | N,2-dihydroxy-N'-[3-methyl-1-(methylamino)-3-methylsulfonyl-1-oxobutan-2-yl]-3-(2-methylpropyl)butanediamide |
|---|---|
| PubChem CID | 54385621 |
| Molecular Formula | C15H29N3O7S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | N,2-dihydroxy-N'-[3-methyl-1-(methylamino)-3-methylsulfonyl-1-oxobutan-2-yl]-3-(2-methylpropyl)butanediamide |
| SMILES | CNC(=O)C(NC(=O)C(CC(C)C)C(O)C(=O)NO)C(C)(C)S(C)(=O)=O |
| InChI | InChI=1S/C15H29N3O7S/c1-8(2)7-9(10(19)13(21)18-23)12(20)17-11(14(22)16-5)15(3,4)26(6,24)25/h8-11,19,23H,7H2,1-6H3,(H,16,22)(H,17,20)(H,18,21) |
| InChIKey | VDANJLHLERIOHV-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 161.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|