C15H29N3O5 — CID 135281872
N-[2,2-dimethyl-4-(methylamino)-4-oxobutyl]-N',3-dihydroxy-2-(2-methylpropyl)butanediamide (PubChem CID 135281872) has the molecular formula C15H29N3O5 and a molecular weight of 331.41 g/mol. Its IUPAC name is N-[2,2-dimethyl-4-(methylamino)-4-oxobutyl]-N',3-dihydroxy-2-(2-methylpropyl)butanediamide.
| Compound Name | N-[2,2-dimethyl-4-(methylamino)-4-oxobutyl]-N',3-dihydroxy-2-(2-methylpropyl)butanediamide |
|---|---|
| PubChem CID | 135281872 |
| Molecular Formula | C15H29N3O5 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | N-[2,2-dimethyl-4-(methylamino)-4-oxobutyl]-N',3-dihydroxy-2-(2-methylpropyl)butanediamide |
| SMILES | CNC(=O)CC(C)(C)CNC(=O)C(CC(C)C)C(O)C(=O)NO |
| InChI | InChI=1S/C15H29N3O5/c1-9(2)6-10(12(20)14(22)18-23)13(21)17-8-15(3,4)7-11(19)16-5/h9-10,12,20,23H,6-8H2,1-5H3,(H,16,19)(H,17,21)(H,18,22) |
| InChIKey | XIZILTLSTMBOTM-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|