C14H28N2O2 — CID 54555561
N,N',3,3,6,6-hexamethyloctanediamide (PubChem CID 54555561) has the molecular formula C14H28N2O2 and a molecular weight of 256.39 g/mol. Its IUPAC name is N,N',3,3,6,6-hexamethyloctanediamide.
| Compound Name | N,N',3,3,6,6-hexamethyloctanediamide |
|---|---|
| PubChem CID | 54555561 |
| Molecular Formula | C14H28N2O2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | N,N',3,3,6,6-hexamethyloctanediamide |
| SMILES | CNC(=O)CC(C)(C)CCC(C)(C)CC(=O)NC |
| InChI | InChI=1S/C14H28N2O2/c1-13(2,9-11(17)15-5)7-8-14(3,4)10-12(18)16-6/h7-10H2,1-6H3,(H,15,17)(H,16,18) |
| InChIKey | ZMXWDIOBRHHQHR-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |