C12H26N4O2 — CID 123887942
3,3,6,6-tetramethyloctanedihydrazide (PubChem CID 123887942) has the molecular formula C12H26N4O2 and a molecular weight of 258.37 g/mol. Its IUPAC name is 3,3,6,6-tetramethyloctanedihydrazide.
| Compound Name | 3,3,6,6-tetramethyloctanedihydrazide |
|---|---|
| PubChem CID | 123887942 |
| Molecular Formula | C12H26N4O2 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | 3,3,6,6-tetramethyloctanedihydrazide |
| SMILES | CC(C)(CCC(C)(C)CC(=O)NN)CC(=O)NN |
| InChI | InChI=1S/C12H26N4O2/c1-11(2,7-9(17)15-13)5-6-12(3,4)8-10(18)16-14/h5-8,13-14H2,1-4H3,(H,15,17)(H,16,18) |
| InChIKey | SVBXVNJGXVBOAY-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|