About propanehydrazide;dihydrochloride
propanehydrazide;dihydrochloride (PubChem CID 121342206) has the molecular formula C3H10Cl2N2O
and a molecular weight of 161.03 g/mol. Its IUPAC name is propanehydrazide;dihydrochloride.
Molecular Properties
| Compound Name | propanehydrazide;dihydrochloride |
| PubChem CID | 121342206 |
| Molecular Formula | C3H10Cl2N2O |
| Molecular Weight | 161.03 g/mol |
| Exact Mass | 160.02 |
| IUPAC Name | propanehydrazide;dihydrochloride |
| SMILES | CCC(=O)NN.Cl.Cl |
| InChI | InChI=1S/C3H8N2O.2ClH/c1-2-3(6)5-4;;/h2,4H2,1H3,(H,5,6);2*1H |
| InChIKey | LSJMIEZSYRMIMB-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.03 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze propanehydrazide;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propanehydrazide;dihydrochloride?
The IUPAC name of propanehydrazide;dihydrochloride (CID 121342206) is propanehydrazide;dihydrochloride.
What is the SMILES notation for propanehydrazide;dihydrochloride?
The canonical SMILES for propanehydrazide;dihydrochloride is CCC(=O)NN.Cl.Cl.
What is the InChIKey of propanehydrazide;dihydrochloride?
The InChIKey is LSJMIEZSYRMIMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8N2O.2ClH/c1-2-3(6)5-4;;/h2,4H2,1H3,(H,5,6);2*1H.
What are the key properties of propanehydrazide;dihydrochloride?
propanehydrazide;dihydrochloride has a molecular weight of 161.03 g/mol, XLogP of 0.23, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propanehydrazide;dihydrochloride is sourced from PubChem (CID 121342206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).