C5H12ClN3O2 — CID 130621835
3-hydrazinyl-N,N-dimethyl-3-oxopropanamide;hydrochloride (PubChem CID 130621835) has the molecular formula C5H12ClN3O2 and a molecular weight of 181.62 g/mol. Its IUPAC name is 3-hydrazinyl-N,N-dimethyl-3-oxopropanamide;hydrochloride.
| Compound Name | 3-hydrazinyl-N,N-dimethyl-3-oxopropanamide;hydrochloride |
|---|---|
| PubChem CID | 130621835 |
| Molecular Formula | C5H12ClN3O2 |
| Molecular Weight | 181.62 g/mol |
| Exact Mass | 181.06 |
| IUPAC Name | 3-hydrazinyl-N,N-dimethyl-3-oxopropanamide;hydrochloride |
| SMILES | CN(C)C(=O)CC(=O)NN.Cl |
| InChI | InChI=1S/C5H11N3O2.ClH/c1-8(2)5(10)3-4(9)7-6;/h3,6H2,1-2H3,(H,7,9);1H |
| InChIKey | FUZQNHWKAKCKGL-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.62 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|