C18H30N6O3 — CID 91021399
2-[2,4,6-triethyl-3,5-bis(2-hydrazinyl-2-oxoethyl)phenyl]acetohydrazide (PubChem CID 91021399) has the molecular formula C18H30N6O3 and a molecular weight of 378.48 g/mol. Its IUPAC name is 2-[2,4,6-triethyl-3,5-bis(2-hydrazinyl-2-oxoethyl)phenyl]acetohydrazide.
| Compound Name | 2-[2,4,6-triethyl-3,5-bis(2-hydrazinyl-2-oxoethyl)phenyl]acetohydrazide |
|---|---|
| PubChem CID | 91021399 |
| Molecular Formula | C18H30N6O3 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | 2-[2,4,6-triethyl-3,5-bis(2-hydrazinyl-2-oxoethyl)phenyl]acetohydrazide |
| SMILES | CCc1c(CC(=O)NN)c(CC)c(CC(=O)NN)c(CC)c1CC(=O)NN |
| InChI | InChI=1S/C18H30N6O3/c1-4-10-13(7-16(25)22-19)11(5-2)15(9-18(27)24-21)12(6-3)14(10)8-17(26)23-20/h4-9,19-21H2,1-3H3,(H,22,25)(H,23,26)(H,24,27) |
| InChIKey | TYROKZVZGQSNGF-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 165.36 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|