About N-bromopropanamide
N-bromopropanamide (PubChem CID 15647963) has the molecular formula C3H6BrNO
and a molecular weight of 151.99 g/mol. Its IUPAC name is N-bromopropanamide.
Molecular Properties
| Compound Name | N-bromopropanamide |
| PubChem CID | 15647963 |
| Molecular Formula | C3H6BrNO |
| Molecular Weight | 151.99 g/mol |
| Exact Mass | 150.96 |
| IUPAC Name | N-bromopropanamide |
| SMILES | CCC(=O)NBr |
| InChI | InChI=1S/C3H6BrNO/c1-2-3(6)5-4/h2H2,1H3,(H,5,6) |
| InChIKey | AMYQBWGTTRGDLR-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.99 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N-bromopropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-bromopropanamide?
The IUPAC name of N-bromopropanamide (CID 15647963) is N-bromopropanamide.
What is the SMILES notation for N-bromopropanamide?
The canonical SMILES for N-bromopropanamide is CCC(=O)NBr.
What is the InChIKey of N-bromopropanamide?
The InChIKey is AMYQBWGTTRGDLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6BrNO/c1-2-3(6)5-4/h2H2,1H3,(H,5,6).
What are the key properties of N-bromopropanamide?
N-bromopropanamide has a molecular weight of 151.99 g/mol, XLogP of 0.82, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-bromopropanamide is sourced from PubChem (CID 15647963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).