C5H8Br3NO2 — CID 95560516
N-[(1S)-2,2,2-tribromo-1-hydroxyethyl]propanamide (PubChem CID 95560516) has the molecular formula C5H8Br3NO2 and a molecular weight of 353.84 g/mol. Its IUPAC name is N-[(1S)-2,2,2-tribromo-1-hydroxyethyl]propanamide.
| Compound Name | N-[(1S)-2,2,2-tribromo-1-hydroxyethyl]propanamide |
|---|---|
| PubChem CID | 95560516 |
| Molecular Formula | C5H8Br3NO2 |
| Molecular Weight | 353.84 g/mol |
| Exact Mass | 350.81 |
| IUPAC Name | N-[(1S)-2,2,2-tribromo-1-hydroxyethyl]propanamide |
| SMILES | CCC(=O)N[C@@H](O)C(Br)(Br)Br |
| InChI | InChI=1S/C5H8Br3NO2/c1-2-3(10)9-4(11)5(6,7)8/h4,11H,2H2,1H3,(H,9,10)/t4-/m0/s1 |
| InChIKey | RYYXOJMOUINZEF-BYPYZUCNSA-N |
| XLogP | 1.67 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.84 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|