C17H34N2O2 — CID 91353745
3,3,11,11-tetramethyltridecanediamide (PubChem CID 91353745) has the molecular formula C17H34N2O2 and a molecular weight of 298.47 g/mol. Its IUPAC name is 3,3,11,11-tetramethyltridecanediamide.
| Compound Name | 3,3,11,11-tetramethyltridecanediamide |
|---|---|
| PubChem CID | 91353745 |
| Molecular Formula | C17H34N2O2 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.26 |
| IUPAC Name | 3,3,11,11-tetramethyltridecanediamide |
| SMILES | CC(C)(CCCCCCCC(C)(C)CC(N)=O)CC(N)=O |
| InChI | InChI=1S/C17H34N2O2/c1-16(2,12-14(18)20)10-8-6-5-7-9-11-17(3,4)13-15(19)21/h5-13H2,1-4H3,(H2,18,20)(H2,19,21) |
| InChIKey | NKKNCABFNQBOGU-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|