C8H15N3O3 — CID 86237649
3-(2-amino-2-oxoethyl)-3-methylpentanediamide (PubChem CID 86237649) has the molecular formula C8H15N3O3 and a molecular weight of 201.23 g/mol. Its IUPAC name is 3-(2-amino-2-oxoethyl)-3-methylpentanediamide.
| Compound Name | 3-(2-amino-2-oxoethyl)-3-methylpentanediamide |
|---|---|
| PubChem CID | 86237649 |
| Molecular Formula | C8H15N3O3 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.11 |
| IUPAC Name | 3-(2-amino-2-oxoethyl)-3-methylpentanediamide |
| SMILES | CC(CC(N)=O)(CC(N)=O)CC(N)=O |
| InChI | InChI=1S/C8H15N3O3/c1-8(2-5(9)12,3-6(10)13)4-7(11)14/h2-4H2,1H3,(H2,9,12)(H2,10,13)(H2,11,14) |
| InChIKey | OUVXTSWDHVPXFF-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 129.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |