C11H24NOY- — CID 154649078
3,3-dimethylbutanamide;2-methanidyl-2-methylpropane;yttrium (PubChem CID 154649078) has the molecular formula C11H24NOY- and a molecular weight of 275.23 g/mol. Its IUPAC name is 3,3-dimethylbutanamide;2-methanidyl-2-methylpropane;yttrium.
| Compound Name | 3,3-dimethylbutanamide;2-methanidyl-2-methylpropane;yttrium |
|---|---|
| PubChem CID | 154649078 |
| Molecular Formula | C11H24NOY- |
| Molecular Weight | 275.23 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 3,3-dimethylbutanamide;2-methanidyl-2-methylpropane;yttrium |
| SMILES | CC(C)(C)CC(N)=O.[CH2-]C(C)(C)C.[Y] |
| InChI | InChI=1S/C6H13NO.C5H11.Y/c1-6(2,3)4-5(7)8;1-5(2,3)4;/h4H2,1-3H3,(H2,7,8);1H2,2-4H3;/q;-1; |
| InChIKey | LZFQHOLGFHDNNB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.23 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|