C9H22N2O3S — CID 142978223
3-aminopropane-1-sulfinic acid;3,3-dimethylbutanamide (PubChem CID 142978223) has the molecular formula C9H22N2O3S and a molecular weight of 238.35 g/mol. Its IUPAC name is 3-aminopropane-1-sulfinic acid;3,3-dimethylbutanamide.
| Compound Name | 3-aminopropane-1-sulfinic acid;3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 142978223 |
| Molecular Formula | C9H22N2O3S |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 3-aminopropane-1-sulfinic acid;3,3-dimethylbutanamide |
| SMILES | CC(C)(C)CC(N)=O.NCCCS(=O)O |
| InChI | InChI=1S/C6H13NO.C3H9NO2S/c1-6(2,3)4-5(7)8;4-2-1-3-7(5)6/h4H2,1-3H3,(H2,7,8);1-4H2,(H,5,6) |
| InChIKey | KQYDRDDGPXAOHN-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|