C10H21NOW — CID 148872040
ethane;N-ethyl-3,3-dimethylbutanamide;tungsten(2+) (PubChem CID 148872040) has the molecular formula C10H21NOW and a molecular weight of 355.12 g/mol. Its IUPAC name is ethane;N-ethyl-3,3-dimethylbutanamide;tungsten(2+).
| Compound Name | ethane;N-ethyl-3,3-dimethylbutanamide;tungsten(2+) |
|---|---|
| PubChem CID | 148872040 |
| Molecular Formula | C10H21NOW |
| Molecular Weight | 355.12 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | ethane;N-ethyl-3,3-dimethylbutanamide;tungsten(2+) |
| SMILES | [CH2-]C.[CH2-]CNC(=O)CC(C)(C)C.[W+2] |
| InChI | InChI=1S/C8H16NO.C2H5.W/c1-5-9-7(10)6-8(2,3)4;1-2;/h1,5-6H2,2-4H3,(H,9,10);1H2,2H3;/q2*-1;+2 |
| InChIKey | PBJGNKQLAOKOFB-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.12 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|