C11H24N2O — CID 59184455
N-[(tert-butylamino)methyl]-3,3-dimethylbutanamide (PubChem CID 59184455) has the molecular formula C11H24N2O and a molecular weight of 200.33 g/mol. Its IUPAC name is N-[(tert-butylamino)methyl]-3,3-dimethylbutanamide.
| Compound Name | N-[(tert-butylamino)methyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 59184455 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | N-[(tert-butylamino)methyl]-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)CC(=O)NCNC(C)(C)C |
| InChI | InChI=1S/C11H24N2O/c1-10(2,3)7-9(14)12-8-13-11(4,5)6/h13H,7-8H2,1-6H3,(H,12,14) |
| InChIKey | JJRHSWSWMGLWCT-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|