C16H31N3O3 — CID 134443497
N'-tert-butyl-N-[2-(3,3-dimethylbutanoylamino)ethyl]butanediamide (PubChem CID 134443497) has the molecular formula C16H31N3O3 and a molecular weight of 313.44 g/mol. Its IUPAC name is N'-tert-butyl-N-[2-(3,3-dimethylbutanoylamino)ethyl]butanediamide.
| Compound Name | N'-tert-butyl-N-[2-(3,3-dimethylbutanoylamino)ethyl]butanediamide |
|---|---|
| PubChem CID | 134443497 |
| Molecular Formula | C16H31N3O3 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.24 |
| IUPAC Name | N'-tert-butyl-N-[2-(3,3-dimethylbutanoylamino)ethyl]butanediamide |
| SMILES | CC(C)(C)CC(=O)NCCNC(=O)CCC(=O)NC(C)(C)C |
| InChI | InChI=1S/C16H31N3O3/c1-15(2,3)11-14(22)18-10-9-17-12(20)7-8-13(21)19-16(4,5)6/h7-11H2,1-6H3,(H,17,20)(H,18,22)(H,19,21) |
| InChIKey | CDHPPHRUEAVLOE-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|