C13H26N2O4 — CID 145127892
(1-hydroxy-2-methylpropan-2-yl) N-[2-(3,3-dimethylbutanoylamino)ethyl]carbamate (PubChem CID 145127892) has the molecular formula C13H26N2O4 and a molecular weight of 274.36 g/mol. Its IUPAC name is (1-hydroxy-2-methylpropan-2-yl) N-[2-(3,3-dimethylbutanoylamino)ethyl]carbamate.
| Compound Name | (1-hydroxy-2-methylpropan-2-yl) N-[2-(3,3-dimethylbutanoylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 145127892 |
| Molecular Formula | C13H26N2O4 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | (1-hydroxy-2-methylpropan-2-yl) N-[2-(3,3-dimethylbutanoylamino)ethyl]carbamate |
| SMILES | CC(C)(C)CC(=O)NCCNC(=O)OC(C)(C)CO |
| InChI | InChI=1S/C13H26N2O4/c1-12(2,3)8-10(17)14-6-7-15-11(18)19-13(4,5)9-16/h16H,6-9H2,1-5H3,(H,14,17)(H,15,18) |
| InChIKey | PYWOWIVZTZBIMO-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|