C21H39N3O4S2 — CID 142135597
6-[3-[6-(cyanoamino)-4,4-dimethyl-6-oxohexyl]sulfinylpropylsulfinyl]-N,3,3-trimethylhexanamide (PubChem CID 142135597) has the molecular formula C21H39N3O4S2 and a molecular weight of 461.69 g/mol. Its IUPAC name is 6-[3-[6-(cyanoamino)-4,4-dimethyl-6-oxohexyl]sulfinylpropylsulfinyl]-N,3,3-trimethylhexanamide.
| Compound Name | 6-[3-[6-(cyanoamino)-4,4-dimethyl-6-oxohexyl]sulfinylpropylsulfinyl]-N,3,3-trimethylhexanamide |
|---|---|
| PubChem CID | 142135597 |
| Molecular Formula | C21H39N3O4S2 |
| Molecular Weight | 461.69 g/mol |
| Exact Mass | 461.24 |
| IUPAC Name | 6-[3-[6-(cyanoamino)-4,4-dimethyl-6-oxohexyl]sulfinylpropylsulfinyl]-N,3,3-trimethylhexanamide |
| SMILES | CNC(=O)CC(C)(C)CCCS(=O)CCCS(=O)CCCC(C)(C)CC(=O)NC#N |
| InChI | InChI=1S/C21H39N3O4S2/c1-20(2,15-18(25)23-5)9-6-11-29(27)13-8-14-30(28)12-7-10-21(3,4)16-19(26)24-17-22/h6-16H2,1-5H3,(H,23,25)(H,24,26) |
| InChIKey | RICVATQLAVEIJA-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 116.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.69 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|