C23H36N4O4 — CID 20631225
N,N'-dicyano-3,3,15,15-tetramethyl-7,11-dioxoheptadecanediamide (PubChem CID 20631225) has the molecular formula C23H36N4O4 and a molecular weight of 432.57 g/mol. Its IUPAC name is N,N'-dicyano-3,3,15,15-tetramethyl-7,11-dioxoheptadecanediamide.
| Compound Name | N,N'-dicyano-3,3,15,15-tetramethyl-7,11-dioxoheptadecanediamide |
|---|---|
| PubChem CID | 20631225 |
| Molecular Formula | C23H36N4O4 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | N,N'-dicyano-3,3,15,15-tetramethyl-7,11-dioxoheptadecanediamide |
| SMILES | CC(C)(CCCC(=O)CCCC(=O)CCCC(C)(C)CC(=O)NC#N)CC(=O)NC#N |
| InChI | InChI=1S/C23H36N4O4/c1-22(2,14-20(30)26-16-24)12-6-10-18(28)8-5-9-19(29)11-7-13-23(3,4)15-21(31)27-17-25/h5-15H2,1-4H3,(H,26,30)(H,27,31) |
| InChIKey | OMSNFLBHTFAJEZ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 139.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|