About N-cyanododecanamide;zinc
N-cyanododecanamide;zinc (PubChem CID 88641506) has the molecular formula C13H24N2OZn
and a molecular weight of 289.74 g/mol. Its IUPAC name is N-cyanododecanamide;zinc.
Molecular Properties
| Compound Name | N-cyanododecanamide;zinc |
| PubChem CID | 88641506 |
| Molecular Formula | C13H24N2OZn |
| Molecular Weight | 289.74 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | N-cyanododecanamide;zinc |
| SMILES | CCCCCCCCCCCC(=O)NC#N.[Zn] |
| InChI | InChI=1S/C13H24N2O.Zn/c1-2-3-4-5-6-7-8-9-10-11-13(16)15-12-14;/h2-11H2,1H3,(H,15,16); |
| InChIKey | PQLVSOMEECPYNK-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.74 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N-cyanododecanamide;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyanododecanamide;zinc?
The IUPAC name of N-cyanododecanamide;zinc (CID 88641506) is N-cyanododecanamide;zinc.
What is the SMILES notation for N-cyanododecanamide;zinc?
The canonical SMILES for N-cyanododecanamide;zinc is CCCCCCCCCCCC(=O)NC#N.[Zn].
What is the InChIKey of N-cyanododecanamide;zinc?
The InChIKey is PQLVSOMEECPYNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2O.Zn/c1-2-3-4-5-6-7-8-9-10-11-13(16)15-12-14;/h2-11H2,1H3,(H,15,16);.
What are the key properties of N-cyanododecanamide;zinc?
N-cyanododecanamide;zinc has a molecular weight of 289.74 g/mol, XLogP of 3.50, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyanododecanamide;zinc is sourced from PubChem (CID 88641506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).