C21H40O4 — CID 23431441
1,17-dihydroxy-3,3,15,15-tetramethylheptadecane-7,11-dione (PubChem CID 23431441) has the molecular formula C21H40O4 and a molecular weight of 356.55 g/mol. Its IUPAC name is 1,17-dihydroxy-3,3,15,15-tetramethylheptadecane-7,11-dione.
| Compound Name | 1,17-dihydroxy-3,3,15,15-tetramethylheptadecane-7,11-dione |
|---|---|
| PubChem CID | 23431441 |
| Molecular Formula | C21H40O4 |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.29 |
| IUPAC Name | 1,17-dihydroxy-3,3,15,15-tetramethylheptadecane-7,11-dione |
| SMILES | CC(C)(CCO)CCCC(=O)CCCC(=O)CCCC(C)(C)CCO |
| InChI | InChI=1S/C21H40O4/c1-20(2,14-16-22)12-6-10-18(24)8-5-9-19(25)11-7-13-21(3,4)15-17-23/h22-23H,5-17H2,1-4H3 |
| InChIKey | WNTRDUSPCVLOPJ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |