C19H34N2O5S2 — CID 18752527
6-[2-[6-(cyanoamino)-3,3-dimethyl-6-oxohexyl]sulfinylethylsulfinyl]-4,4-dimethylhexanoic acid (PubChem CID 18752527) has the molecular formula C19H34N2O5S2 and a molecular weight of 434.62 g/mol. Its IUPAC name is 6-[2-[6-(cyanoamino)-3,3-dimethyl-6-oxohexyl]sulfinylethylsulfinyl]-4,4-dimethylhexanoic acid.
| Compound Name | 6-[2-[6-(cyanoamino)-3,3-dimethyl-6-oxohexyl]sulfinylethylsulfinyl]-4,4-dimethylhexanoic acid |
|---|---|
| PubChem CID | 18752527 |
| Molecular Formula | C19H34N2O5S2 |
| Molecular Weight | 434.62 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | 6-[2-[6-(cyanoamino)-3,3-dimethyl-6-oxohexyl]sulfinylethylsulfinyl]-4,4-dimethylhexanoic acid |
| SMILES | CC(C)(CCC(=O)O)CCS(=O)CCS(=O)CCC(C)(C)CCC(=O)NC#N |
| InChI | InChI=1S/C19H34N2O5S2/c1-18(2,7-5-16(22)21-15-20)9-11-27(25)13-14-28(26)12-10-19(3,4)8-6-17(23)24/h5-14H2,1-4H3,(H,21,22)(H,23,24) |
| InChIKey | IHYVKJNRMIQTHW-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 124.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.62 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|