C9H18N2O4 — CID 90478336
(2S,3R)-N,2-dihydroxy-N'-methyl-3-(2-methylpropyl)butanediamide (PubChem CID 90478336) has the molecular formula C9H18N2O4 and a molecular weight of 218.25 g/mol. Its IUPAC name is (2S,3R)-N,2-dihydroxy-N'-methyl-3-(2-methylpropyl)butanediamide.
| Compound Name | (2S,3R)-N,2-dihydroxy-N'-methyl-3-(2-methylpropyl)butanediamide |
|---|---|
| PubChem CID | 90478336 |
| Molecular Formula | C9H18N2O4 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | (2S,3R)-N,2-dihydroxy-N'-methyl-3-(2-methylpropyl)butanediamide |
| SMILES | CNC(=O)C(CC(C)C)[C@H](O)C(=O)NO |
| InChI | InChI=1S/C9H18N2O4/c1-5(2)4-6(8(13)10-3)7(12)9(14)11-15/h5-7,12,15H,4H2,1-3H3,(H,10,13)(H,11,14)/t6?,7-/m0/s1 |
| InChIKey | QOALOSWUHLXFGM-MLWJPKLSSA-N |
| XLogP | -0.74 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|