C7H14BrNO — CID 59001731
(2S)-2-bromo-N,4-dimethylpentanamide (PubChem CID 59001731) has the molecular formula C7H14BrNO and a molecular weight of 208.10 g/mol. Its IUPAC name is (2S)-2-bromo-N,4-dimethylpentanamide.
| Compound Name | (2S)-2-bromo-N,4-dimethylpentanamide |
|---|---|
| PubChem CID | 59001731 |
| Molecular Formula | C7H14BrNO |
| Molecular Weight | 208.10 g/mol |
| Exact Mass | 207.03 |
| IUPAC Name | (2S)-2-bromo-N,4-dimethylpentanamide |
| SMILES | CNC(=O)[C@@H](Br)CC(C)C |
| InChI | InChI=1S/C7H14BrNO/c1-5(2)4-6(8)7(10)9-3/h5-6H,4H2,1-3H3,(H,9,10)/t6-/m0/s1 |
| InChIKey | QKADZGNIPYJCPD-LURJTMIESA-N |
| XLogP | 1.54 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.10 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|