C34H51N3O9 — CID 15851481
(2R)-N'-[(2,4-dimethoxyphenyl)methoxy]-N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-2-(2-methylpropyl)-N'-[(2,4,6-trimethoxyphenyl)methyl]butanediamide (PubChem CID 15851481) has the molecular formula C34H51N3O9 and a molecular weight of 645.79 g/mol. Its IUPAC name is (2R)-N'-[(2,4-dimethoxyphenyl)methoxy]-N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-2-(2-methylpropyl)-N'-[(2,4,6-trimethoxyphenyl)methyl]butanediamide.
| Compound Name | (2R)-N'-[(2,4-dimethoxyphenyl)methoxy]-N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-2-(2-methylpropyl)-N'-[(2,4,6-trimethoxyphenyl)methyl]butanediamide |
|---|---|
| PubChem CID | 15851481 |
| Molecular Formula | C34H51N3O9 |
| Molecular Weight | 645.79 g/mol |
| Exact Mass | 645.36 |
| IUPAC Name | (2R)-N'-[(2,4-dimethoxyphenyl)methoxy]-N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-2-(2-methylpropyl)-N'-[(2,4,6-trimethoxyphenyl)methyl]butanediamide |
| SMILES | CNC(=O)[C@@H](NC(=O)C(CC(=O)N(Cc1c(OC)cc(OC)cc1OC)OCc1ccc(OC)cc1OC)CC(C)C)C(C)(C)C |
| InChI | InChI=1S/C34H51N3O9/c1-21(2)14-23(32(39)36-31(33(40)35-6)34(3,4)5)15-30(38)37(46-20-22-12-13-24(41-7)16-27(22)43-9)19-26-28(44-10)17-25(42-8)18-29(26)45-11/h12-13,16-18,21,23,31H,14-15,19-20H2,1-11H3,(H,35,40)(H,36,39)/t23?,31-/m1/s1 |
| InChIKey | MIRPBVMYMQWEDR-ORLYWQOISA-N |
| XLogP | 4.52 |
| TPSA | 133.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.79 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|