C18H25Cl2NO3 — CID 101258326
2,2-dichloro-N-[(2,4-dimethoxyphenyl)methyl]-N-[(Z)-5-methylhex-2-en-3-yl]acetamide (PubChem CID 101258326) has the molecular formula C18H25Cl2NO3 and a molecular weight of 374.31 g/mol. Its IUPAC name is 2,2-dichloro-N-[(2,4-dimethoxyphenyl)methyl]-N-[(Z)-5-methylhex-2-en-3-yl]acetamide.
| Compound Name | 2,2-dichloro-N-[(2,4-dimethoxyphenyl)methyl]-N-[(Z)-5-methylhex-2-en-3-yl]acetamide |
|---|---|
| PubChem CID | 101258326 |
| Molecular Formula | C18H25Cl2NO3 |
| Molecular Weight | 374.31 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 2,2-dichloro-N-[(2,4-dimethoxyphenyl)methyl]-N-[(Z)-5-methylhex-2-en-3-yl]acetamide |
| SMILES | C/C=C(/CC(C)C)N(Cc1ccc(OC)cc1OC)C(=O)C(Cl)Cl |
| InChI | InChI=1S/C18H25Cl2NO3/c1-6-14(9-12(2)3)21(18(22)17(19)20)11-13-7-8-15(23-4)10-16(13)24-5/h6-8,10,12,17H,9,11H2,1-5H3/b14-6- |
| InChIKey | NHIMOUYXJGYNAQ-NSIKDUERSA-N |
| XLogP | 4.79 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.31 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|