C30H43N3O4 — CID 127044680
2-[3-(3-tert-butyl-4-phenylphenyl)propyl]-N-[3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-N'-hydroxybutanediamide (PubChem CID 127044680) has the molecular formula C30H43N3O4 and a molecular weight of 509.69 g/mol. Its IUPAC name is 2-[3-(3-tert-butyl-4-phenylphenyl)propyl]-N-[3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-N'-hydroxybutanediamide.
| Compound Name | 2-[3-(3-tert-butyl-4-phenylphenyl)propyl]-N-[3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-N'-hydroxybutanediamide |
|---|---|
| PubChem CID | 127044680 |
| Molecular Formula | C30H43N3O4 |
| Molecular Weight | 509.69 g/mol |
| Exact Mass | 509.33 |
| IUPAC Name | 2-[3-(3-tert-butyl-4-phenylphenyl)propyl]-N-[3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-N'-hydroxybutanediamide |
| SMILES | CNC(=O)C(NC(=O)C(CCCc1ccc(-c2ccccc2)c(C(C)(C)C)c1)CC(=O)NO)C(C)(C)C |
| InChI | InChI=1S/C30H43N3O4/c1-29(2,3)24-18-20(16-17-23(24)21-13-9-8-10-14-21)12-11-15-22(19-25(34)33-37)27(35)32-26(28(36)31-7)30(4,5)6/h8-10,13-14,16-18,22,26,37H,11-12,15,19H2,1-7H3,(H,31,36)(H,32,35)(H,33,34) |
| InChIKey | DULNZCIUQFFMOE-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.69 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|