C34H43N3O5 — CID 75002250
N'-hydroxy-N-[1-[[methoxy(phenyl)methyl]amino]-3,3-dimethyl-1-oxobutan-2-yl]-2-[3-(3-methyl-4-phenylphenyl)propyl]butanediamide (PubChem CID 75002250) has the molecular formula C34H43N3O5 and a molecular weight of 573.73 g/mol. Its IUPAC name is N'-hydroxy-N-[1-[[methoxy(phenyl)methyl]amino]-3,3-dimethyl-1-oxobutan-2-yl]-2-[3-(3-methyl-4-phenylphenyl)propyl]butanediamide.
| Compound Name | N'-hydroxy-N-[1-[[methoxy(phenyl)methyl]amino]-3,3-dimethyl-1-oxobutan-2-yl]-2-[3-(3-methyl-4-phenylphenyl)propyl]butanediamide |
|---|---|
| PubChem CID | 75002250 |
| Molecular Formula | C34H43N3O5 |
| Molecular Weight | 573.73 g/mol |
| Exact Mass | 573.32 |
| IUPAC Name | N'-hydroxy-N-[1-[[methoxy(phenyl)methyl]amino]-3,3-dimethyl-1-oxobutan-2-yl]-2-[3-(3-methyl-4-phenylphenyl)propyl]butanediamide |
| SMILES | COC(NC(=O)C(NC(=O)C(CCCc1ccc(-c2ccccc2)c(C)c1)CC(=O)NO)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C34H43N3O5/c1-23-21-24(19-20-28(23)25-14-8-6-9-15-25)13-12-18-27(22-29(38)37-41)31(39)35-30(34(2,3)4)32(40)36-33(42-5)26-16-10-7-11-17-26/h6-11,14-17,19-21,27,30,33,41H,12-13,18,22H2,1-5H3,(H,35,39)(H,36,40)(H,37,38) |
| InChIKey | MDNBGABATBOAOY-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.73 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|