C23H30N2O5 — CID 139919251
N-(1,3-dihydroxybutan-2-yl)-N'-hydroxy-2-[3-(4-phenylphenyl)propyl]butanediamide (PubChem CID 139919251) has the molecular formula C23H30N2O5 and a molecular weight of 414.50 g/mol. Its IUPAC name is N-(1,3-dihydroxybutan-2-yl)-N'-hydroxy-2-[3-(4-phenylphenyl)propyl]butanediamide.
| Compound Name | N-(1,3-dihydroxybutan-2-yl)-N'-hydroxy-2-[3-(4-phenylphenyl)propyl]butanediamide |
|---|---|
| PubChem CID | 139919251 |
| Molecular Formula | C23H30N2O5 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | N-(1,3-dihydroxybutan-2-yl)-N'-hydroxy-2-[3-(4-phenylphenyl)propyl]butanediamide |
| SMILES | CC(O)C(CO)NC(=O)C(CCCc1ccc(-c2ccccc2)cc1)CC(=O)NO |
| InChI | InChI=1S/C23H30N2O5/c1-16(27)21(15-26)24-23(29)20(14-22(28)25-30)9-5-6-17-10-12-19(13-11-17)18-7-3-2-4-8-18/h2-4,7-8,10-13,16,20-21,26-27,30H,5-6,9,14-15H2,1H3,(H,24,29)(H,25,28) |
| InChIKey | UZWYDTHHQDDNIG-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|