C25H32N2O4 — CID 54175331
N'-hydroxy-N-(2-hydroxycyclohexyl)-2-[3-(4-phenylphenyl)propyl]butanediamide (PubChem CID 54175331) has the molecular formula C25H32N2O4 and a molecular weight of 424.54 g/mol. Its IUPAC name is N'-hydroxy-N-(2-hydroxycyclohexyl)-2-[3-(4-phenylphenyl)propyl]butanediamide.
| Compound Name | N'-hydroxy-N-(2-hydroxycyclohexyl)-2-[3-(4-phenylphenyl)propyl]butanediamide |
|---|---|
| PubChem CID | 54175331 |
| Molecular Formula | C25H32N2O4 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | N'-hydroxy-N-(2-hydroxycyclohexyl)-2-[3-(4-phenylphenyl)propyl]butanediamide |
| SMILES | O=C(CC(CCCc1ccc(-c2ccccc2)cc1)C(=O)NC1CCCCC1O)NO |
| InChI | InChI=1S/C25H32N2O4/c28-23-12-5-4-11-22(23)26-25(30)21(17-24(29)27-31)10-6-7-18-13-15-20(16-14-18)19-8-2-1-3-9-19/h1-3,8-9,13-16,21-23,28,31H,4-7,10-12,17H2,(H,26,30)(H,27,29) |
| InChIKey | OXXOFRIJYPJYLA-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|