C22H29N3O5 — CID 87361625
(2S,3R)-3-hydroxy-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)butan-2-yl]-2-[[2-(4-phenylphenyl)acetyl]amino]butanamide (PubChem CID 87361625) has the molecular formula C22H29N3O5 and a molecular weight of 415.49 g/mol. Its IUPAC name is (2S,3R)-3-hydroxy-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)butan-2-yl]-2-[[2-(4-phenylphenyl)acetyl]amino]butanamide.
| Compound Name | (2S,3R)-3-hydroxy-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)butan-2-yl]-2-[[2-(4-phenylphenyl)acetyl]amino]butanamide |
|---|---|
| PubChem CID | 87361625 |
| Molecular Formula | C22H29N3O5 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | (2S,3R)-3-hydroxy-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)butan-2-yl]-2-[[2-(4-phenylphenyl)acetyl]amino]butanamide |
| SMILES | C[C@@H](O)[C@H](CNO)NC(=O)[C@@H](NC(=O)Cc1ccc(-c2ccccc2)cc1)[C@@H](C)O |
| InChI | InChI=1S/C22H29N3O5/c1-14(26)19(13-23-30)24-22(29)21(15(2)27)25-20(28)12-16-8-10-18(11-9-16)17-6-4-3-5-7-17/h3-11,14-15,19,21,23,26-27,30H,12-13H2,1-2H3,(H,24,29)(H,25,28)/t14-,15-,19+,21+/m1/s1 |
| InChIKey | QGBSZTOMWOGCIT-PIPIOBNBSA-N |
| XLogP | 0.61 |
| TPSA | 130.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|