C23H31N3O6 — CID 158810597
(2S,3R)-3-hydroxy-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-2-[[2-(4-phenylphenyl)acetyl]amino]butanamide;methane (PubChem CID 158810597) has the molecular formula C23H31N3O6 and a molecular weight of 445.52 g/mol. Its IUPAC name is (2S,3R)-3-hydroxy-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-2-[[2-(4-phenylphenyl)acetyl]amino]butanamide;methane.
| Compound Name | (2S,3R)-3-hydroxy-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-2-[[2-(4-phenylphenyl)acetyl]amino]butanamide;methane |
|---|---|
| PubChem CID | 158810597 |
| Molecular Formula | C23H31N3O6 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | (2S,3R)-3-hydroxy-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-2-[[2-(4-phenylphenyl)acetyl]amino]butanamide;methane |
| SMILES | C.C[C@@H](O)[C@H](NC(=O)Cc1ccc(-c2ccccc2)cc1)C(=O)N[C@H](C(=O)NO)[C@@H](C)O |
| InChI | InChI=1S/C22H27N3O6.CH4/c1-13(26)19(21(29)24-20(14(2)27)22(30)25-31)23-18(28)12-15-8-10-17(11-9-15)16-6-4-3-5-7-16;/h3-11,13-14,19-20,26-27,31H,12H2,1-2H3,(H,23,28)(H,24,29)(H,25,30);1H4/t13-,14-,19+,20+;/m1./s1 |
| InChIKey | IUQFFXQXSJNMPS-OMBRBPHWSA-N |
| XLogP | 0.77 |
| TPSA | 147.99 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|