C15H23N3O4 — CID 59697686
(3R)-3-amino-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-5-phenylpentanamide (PubChem CID 59697686) has the molecular formula C15H23N3O4 and a molecular weight of 309.37 g/mol. Its IUPAC name is (3R)-3-amino-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-5-phenylpentanamide.
| Compound Name | (3R)-3-amino-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-5-phenylpentanamide |
|---|---|
| PubChem CID | 59697686 |
| Molecular Formula | C15H23N3O4 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | (3R)-3-amino-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-5-phenylpentanamide |
| SMILES | C[C@@H](O)[C@H](NC(=O)C[C@H](N)CCc1ccccc1)C(=O)NO |
| InChI | InChI=1S/C15H23N3O4/c1-10(19)14(15(21)18-22)17-13(20)9-12(16)8-7-11-5-3-2-4-6-11/h2-6,10,12,14,19,22H,7-9,16H2,1H3,(H,17,20)(H,18,21)/t10-,12-,14+/m1/s1 |
| InChIKey | KUJJJYMXBLREOZ-QKCSRTOESA-N |
| XLogP | -0.29 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|