C24H31N3O5 — CID 87102928
(2S)-N'-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-methyl-2-(4-phenylphenyl)heptanediamide (PubChem CID 87102928) has the molecular formula C24H31N3O5 and a molecular weight of 441.53 g/mol. Its IUPAC name is (2S)-N'-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-methyl-2-(4-phenylphenyl)heptanediamide.
| Compound Name | (2S)-N'-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-methyl-2-(4-phenylphenyl)heptanediamide |
|---|---|
| PubChem CID | 87102928 |
| Molecular Formula | C24H31N3O5 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | (2S)-N'-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-methyl-2-(4-phenylphenyl)heptanediamide |
| SMILES | CC(CCC(=O)N[C@H](C(=O)NO)[C@@H](C)O)C[C@H](C(N)=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H31N3O5/c1-15(8-13-21(29)26-22(16(2)28)24(31)27-32)14-20(23(25)30)19-11-9-18(10-12-19)17-6-4-3-5-7-17/h3-7,9-12,15-16,20,22,28,32H,8,13-14H2,1-2H3,(H2,25,30)(H,26,29)(H,27,31)/t15?,16-,20+,22+/m1/s1 |
| InChIKey | MHMYECGOHNOQPU-QPKGUYFFSA-N |
| XLogP | 2.10 |
| TPSA | 141.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|